trimethyl-(3-trimethylsilylphenoxy)silane structure
|
Common Name | trimethyl-(3-trimethylsilylphenoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 18036-82-3 | Molecular Weight | 238.47300 | |
| Density | 0.89g/cm3 | Boiling Point | 236.8ºC at 760 mmHg | |
| Molecular Formula | C12H22OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 80.7ºC | |
| Name | trimethyl-(3-trimethylsilyloxyphenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.89g/cm3 |
|---|---|
| Boiling Point | 236.8ºC at 760 mmHg |
| Molecular Formula | C12H22OSi2 |
| Molecular Weight | 238.47300 |
| Flash Point | 80.7ºC |
| Exact Mass | 238.12100 |
| PSA | 9.23000 |
| LogP | 3.44550 |
| Vapour Pressure | 0.0713mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | QRBQRYSCIMREIR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Oc1cccc([Si](C)(C)C)c1 |
|
~%
trimethyl-(3-tr... CAS#:18036-82-3 |
| Literature: Benkeser; Krysiak Journal of the American Chemical Society, 1953 , vol. 75, p. 2421,2423 |
|
~%
trimethyl-(3-tr... CAS#:18036-82-3 |
| Literature: Nishide, Kiyoharu; Miyamoto, Tetsuo; Kumar, Kamal; Ohsugi, Shin-Ichi; Node, Manabu Tetrahedron Letters, 2002 , vol. 43, # 47 p. 8569 - 8573 |
| Trimethyl-(3-trimethylsilyl-phenoxy)-silan |
| 3-trimethylsilyphenyl trimethylsilyl ether |
| m-Trimethylsiloxy-trimethylsilylbenzol |
| Trimethyl-(3-trimethylsilyloxy-phenyl)-silan |
| trimethyl{3-[(trimethylsilyl)oxy]phenyl}silane |
| trimethyl-(3-trimethylsilanyloxy-phenyl)-silane |
| m-Trimethylsilyl-phenoxy-trimethylsilan |
| m-trimethylsiloxyphenyltrimethylsilane |