3,4-Dibromo-2,5-difluorophenylacetic acid
Modify Date: 2026-07-16 21:43:00
3,4-Dibromo-2,5-difluorophenylacetic acid structure
|
Common Name | 3,4-Dibromo-2,5-difluorophenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 1803783-39-2 | Molecular Weight | 329.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4Br2F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-Dibromo-2,5-difluorophenylacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4Br2F2O2 |
|---|---|
| Molecular Weight | 329.92 |
| InChIKey | IFHOCKXIMBBWGU-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(F)c(Br)c(Br)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1803783-39-2? |
| A: Chinese name of 1803783-39-2 is 1803783-39-2. |
| Q: What is the CAS number of 3,4-Dibromo-2,5-difluorophenylacetic acid? |
| A: CAS number of 3,4-Dibromo-2,5-difluorophenylacetic acid is 1803783-39-2. |
| Q: What is the molecular formula of 3,4-Dibromo-2,5-difluorophenylacetic acid? |
| A: Molecular formula of 3,4-Dibromo-2,5-difluorophenylacetic acid is C8H4Br2F2O2. |
| Q: What is the English name of 3,4-Dibromo-2,5-difluorophenylacetic acid? |
| A: The English name of 3,4-Dibromo-2,5-difluorophenylacetic acid is 3,4-Dibromo-2,5-difluorophenylacetic acid. |
| Q: What is the molecular weight of 3,4-Dibromo-2,5-difluorophenylacetic acid? |
| A: Molecular weight of 3,4-Dibromo-2,5-difluorophenylacetic acid is 329.92. |
| Q: What is the InChIKey of 3,4-Dibromo-2,5-difluorophenylacetic acid? |
| A: InChIKey of 3,4-Dibromo-2,5-difluorophenylacetic acid is IFHOCKXIMBBWGU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3,4-Dibromo-2,5-difluorophenylacetic acid? |
| A: SMILES notation of 3,4-Dibromo-2,5-difluorophenylacetic acid is O=C(O)Cc1cc(F)c(Br)c(Br)c1F. |