3-(Difluoromethyl)-2,5-difluorobenzamide
Modify Date: 2025-09-10 11:16:32
3-(Difluoromethyl)-2,5-difluorobenzamide structure
|
Common Name | 3-(Difluoromethyl)-2,5-difluorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 1803789-01-6 | Molecular Weight | 207.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(Difluoromethyl)-2,5-difluorobenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5F4NO |
|---|---|
| Molecular Weight | 207.12 |
| InChIKey | ATGRBWKYQCBBIL-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(F)cc(C(F)F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(Difluoromethyl)-2,5-difluorobenzamide? |
| A: The English name of 3-(Difluoromethyl)-2,5-difluorobenzamide is 3-(Difluoromethyl)-2,5-difluorobenzamide. |
| Q: What is the CAS number of 3-(Difluoromethyl)-2,5-difluorobenzamide? |
| A: CAS number of 3-(Difluoromethyl)-2,5-difluorobenzamide is 1803789-01-6. |
| Q: What is the InChIKey of 3-(Difluoromethyl)-2,5-difluorobenzamide? |
| A: InChIKey of 3-(Difluoromethyl)-2,5-difluorobenzamide is ATGRBWKYQCBBIL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(Difluoromethyl)-2,5-difluorobenzamide? |
| A: Molecular formula of 3-(Difluoromethyl)-2,5-difluorobenzamide is C8H5F4NO. |
| Q: What is the Chinese name of 1803789-01-6? |
| A: Chinese name of 1803789-01-6 is 1803789-01-6. |
| Q: What is the SMILES notation of 3-(Difluoromethyl)-2,5-difluorobenzamide? |
| A: SMILES notation of 3-(Difluoromethyl)-2,5-difluorobenzamide is NC(=O)c1cc(F)cc(C(F)F)c1F. |
| Q: What is the molecular weight of 3-(Difluoromethyl)-2,5-difluorobenzamide? |
| A: Molecular weight of 3-(Difluoromethyl)-2,5-difluorobenzamide is 207.12. |