3,4-Dichloro-2-(difluoromethoxy)benzylamine structure
|
Common Name | 3,4-Dichloro-2-(difluoromethoxy)benzylamine | ||
|---|---|---|---|---|
| CAS Number | 1803789-53-8 | Molecular Weight | 242.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7Cl2F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-Dichloro-2-(difluoromethoxy)benzylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7Cl2F2NO |
|---|---|
| Molecular Weight | 242.05 |
| InChIKey | OYQQKRJTRFHCNA-UHFFFAOYSA-N |
| SMILES | NCc1ccc(Cl)c(Cl)c1OC(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,4-Dichloro-2-(difluoromethoxy)benzylamine? |
| A: InChIKey of 3,4-Dichloro-2-(difluoromethoxy)benzylamine is OYQQKRJTRFHCNA-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3,4-Dichloro-2-(difluoromethoxy)benzylamine? |
| A: CAS number of 3,4-Dichloro-2-(difluoromethoxy)benzylamine is 1803789-53-8. |
| Q: What is the SMILES notation of 3,4-Dichloro-2-(difluoromethoxy)benzylamine? |
| A: SMILES notation of 3,4-Dichloro-2-(difluoromethoxy)benzylamine is NCc1ccc(Cl)c(Cl)c1OC(F)F. |
| Q: What is the Chinese name of 1803789-53-8? |
| A: Chinese name of 1803789-53-8 is 1803789-53-8. |
| Q: What is the molecular weight of 3,4-Dichloro-2-(difluoromethoxy)benzylamine? |
| A: Molecular weight of 3,4-Dichloro-2-(difluoromethoxy)benzylamine is 242.05. |
| Q: What is the English name of 3,4-Dichloro-2-(difluoromethoxy)benzylamine? |
| A: The English name of 3,4-Dichloro-2-(difluoromethoxy)benzylamine is 3,4-Dichloro-2-(difluoromethoxy)benzylamine. |
| Q: What is the molecular formula of 3,4-Dichloro-2-(difluoromethoxy)benzylamine? |
| A: Molecular formula of 3,4-Dichloro-2-(difluoromethoxy)benzylamine is C8H7Cl2F2NO. |