Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate
Modify Date: 2025-09-09 16:22:20
Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate structure
|
Common Name | Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 1803791-49-2 | Molecular Weight | 299.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10Cl2F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10Cl2F2O3 |
|---|---|
| Molecular Weight | 299.09 |
| InChIKey | ZZKMIROOTKYWQX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1cc(Cl)c(Cl)c(OC(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate? |
| A: The English name of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate is Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate. |
| Q: What is the molecular formula of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate? |
| A: Molecular formula of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate is C11H10Cl2F2O3. |
| Q: What is the SMILES notation of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate? |
| A: SMILES notation of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate is CCOC(=O)Cc1cc(Cl)c(Cl)c(OC(F)F)c1. |
| Q: What is the CAS number of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate? |
| A: CAS number of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate is 1803791-49-2. |
| Q: What is the molecular weight of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate? |
| A: Molecular weight of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate is 299.09. |
| Q: What is the InChIKey of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate? |
| A: InChIKey of Ethyl 3,4-dichloro-5-(difluoromethoxy)phenylacetate is ZZKMIROOTKYWQX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1803791-49-2? |
| A: Chinese name of 1803791-49-2 is 1803791-49-2. |