4-(Difluoromethyl)-2,6-difluorobenzamide
Modify Date: 2025-09-09 16:38:53
4-(Difluoromethyl)-2,6-difluorobenzamide structure
|
Common Name | 4-(Difluoromethyl)-2,6-difluorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 1803804-41-2 | Molecular Weight | 207.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Difluoromethyl)-2,6-difluorobenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5F4NO |
|---|---|
| Molecular Weight | 207.12 |
| InChIKey | LZSJYHHPDGXASS-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c(F)cc(C(F)F)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(Difluoromethyl)-2,6-difluorobenzamide? |
| A: Molecular formula of 4-(Difluoromethyl)-2,6-difluorobenzamide is C8H5F4NO. |
| Q: What is the SMILES notation of 4-(Difluoromethyl)-2,6-difluorobenzamide? |
| A: SMILES notation of 4-(Difluoromethyl)-2,6-difluorobenzamide is NC(=O)c1c(F)cc(C(F)F)cc1F. |
| Q: What is the English name of 4-(Difluoromethyl)-2,6-difluorobenzamide? |
| A: The English name of 4-(Difluoromethyl)-2,6-difluorobenzamide is 4-(Difluoromethyl)-2,6-difluorobenzamide. |
| Q: What is the Chinese name of 1803804-41-2? |
| A: Chinese name of 1803804-41-2 is 1803804-41-2. |
| Q: What is the molecular weight of 4-(Difluoromethyl)-2,6-difluorobenzamide? |
| A: Molecular weight of 4-(Difluoromethyl)-2,6-difluorobenzamide is 207.12. |
| Q: What is the CAS number of 4-(Difluoromethyl)-2,6-difluorobenzamide? |
| A: CAS number of 4-(Difluoromethyl)-2,6-difluorobenzamide is 1803804-41-2. |
| Q: What is the InChIKey of 4-(Difluoromethyl)-2,6-difluorobenzamide? |
| A: InChIKey of 4-(Difluoromethyl)-2,6-difluorobenzamide is LZSJYHHPDGXASS-UHFFFAOYSA-N. |