Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl)
Modify Date: 2025-09-09 14:04:59
Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl) structure
|
Common Name | Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 1803816-52-5 | Molecular Weight | 339.88 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7HBr2F5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7HBr2F5 |
|---|---|
| Molecular Weight | 339.88 |
| InChIKey | NQWGSKJUUGUWSJ-UHFFFAOYSA-N |
| SMILES | Fc1cc(F)c(Br)c(C(F)(F)F)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl)? |
| A: Molecular formula of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl) is C7HBr2F5. |
| Q: What is the English name of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl)? |
| A: The English name of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl) is Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl). |
| Q: What is the CAS number of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl)? |
| A: CAS number of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl) is 1803816-52-5. |
| Q: What is the Chinese name of 1803816-52-5? |
| A: Chinese name of 1803816-52-5 is 1803816-52-5. |
| Q: What is the SMILES notation of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl)? |
| A: SMILES notation of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl) is Fc1cc(F)c(Br)c(C(F)(F)F)c1Br. |
| Q: What is the molecular weight of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl)? |
| A: Molecular weight of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl) is 339.88. |
| Q: What is the InChIKey of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl)? |
| A: InChIKey of Benzene, 2,4-dibromo-1,5-difluoro-3-(trifluoromethyl) is NQWGSKJUUGUWSJ-UHFFFAOYSA-N. |