4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride
Modify Date: 2025-09-10 01:51:45
4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride structure
|
Common Name | 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1803817-82-4 | Molecular Weight | 311.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Cl3F2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3Cl3F2O3S |
|---|---|
| Molecular Weight | 311.5 |
| InChIKey | BCKPXZLGMUQBGE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cc(Cl)c(Cl)cc1OC(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride? |
| A: The English name of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride is 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride. |
| Q: What is the SMILES notation of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride? |
| A: SMILES notation of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride is O=S(=O)(Cl)c1cc(Cl)c(Cl)cc1OC(F)F. |
| Q: What is the Chinese name of 1803817-82-4? |
| A: Chinese name of 1803817-82-4 is 1803817-82-4. |
| Q: What is the InChIKey of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride? |
| A: InChIKey of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride is BCKPXZLGMUQBGE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride? |
| A: Molecular weight of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride is 311.5. |
| Q: What is the CAS number of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride? |
| A: CAS number of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride is 1803817-82-4. |
| Q: What is the molecular formula of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride? |
| A: Molecular formula of 4,5-Dichloro-2-(difluoromethoxy)benzenesulfonyl chloride is C7H3Cl3F2O3S. |