2-(Difluoromethoxy)-4,6-difluorobenzamide
Modify Date: 2026-08-31 13:02:43
2-(Difluoromethoxy)-4,6-difluorobenzamide structure
|
Common Name | 2-(Difluoromethoxy)-4,6-difluorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 1803826-35-8 | Molecular Weight | 223.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5F4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Difluoromethoxy)-4,6-difluorobenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5F4NO2 |
|---|---|
| Molecular Weight | 223.12 |
| InChIKey | YGKHDXGZQUQLPY-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c(F)cc(F)cc1OC(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(Difluoromethoxy)-4,6-difluorobenzamide? |
| A: Molecular formula of 2-(Difluoromethoxy)-4,6-difluorobenzamide is C8H5F4NO2. |
| Q: What is the CAS number of 2-(Difluoromethoxy)-4,6-difluorobenzamide? |
| A: CAS number of 2-(Difluoromethoxy)-4,6-difluorobenzamide is 1803826-35-8. |
| Q: What is the English name of 2-(Difluoromethoxy)-4,6-difluorobenzamide? |
| A: The English name of 2-(Difluoromethoxy)-4,6-difluorobenzamide is 2-(Difluoromethoxy)-4,6-difluorobenzamide. |
| Q: What is the molecular weight of 2-(Difluoromethoxy)-4,6-difluorobenzamide? |
| A: Molecular weight of 2-(Difluoromethoxy)-4,6-difluorobenzamide is 223.12. |
| Q: What is the InChIKey of 2-(Difluoromethoxy)-4,6-difluorobenzamide? |
| A: InChIKey of 2-(Difluoromethoxy)-4,6-difluorobenzamide is YGKHDXGZQUQLPY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1803826-35-8? |
| A: Chinese name of 1803826-35-8 is 1803826-35-8. |
| Q: What is the SMILES notation of 2-(Difluoromethoxy)-4,6-difluorobenzamide? |
| A: SMILES notation of 2-(Difluoromethoxy)-4,6-difluorobenzamide is NC(=O)c1c(F)cc(F)cc1OC(F)F. |