2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole
Modify Date: 2026-09-28 11:22:27
2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole structure
|
Common Name | 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 1803899-27-5 | Molecular Weight | 238.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3ClF4N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H3ClF4N2 |
|---|---|
| Molecular Weight | 238.57 |
| InChIKey | IPYGSMCXOFILGH-UHFFFAOYSA-N |
| SMILES | Fc1ccc(C(F)(F)F)c2nc(Cl)[nH]c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1803899-27-5? |
| A: Chinese name of 1803899-27-5 is 1803899-27-5. |
| Q: What is the molecular weight of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole? |
| A: Molecular weight of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole is 238.57. |
| Q: What is the CAS number of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole? |
| A: CAS number of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole is 1803899-27-5. |
| Q: What is the molecular formula of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole? |
| A: Molecular formula of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole is C8H3ClF4N2. |
| Q: What is the English name of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole? |
| A: The English name of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole is 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole. |
| Q: What is the SMILES notation of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole? |
| A: SMILES notation of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole is Fc1ccc(C(F)(F)F)c2nc(Cl)[nH]c12. |
| Q: What is the InChIKey of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole? |
| A: InChIKey of 2-Chloro-4-fluoro-7-(trifluoromethyl)-1H-1,3-benzimidazole is IPYGSMCXOFILGH-UHFFFAOYSA-N. |