6-methyl-3-phenyl-1H-pyrimidine-2,4-dione structure
|
Common Name | 6-methyl-3-phenyl-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 1804-04-2 | Molecular Weight | 202.20900 | |
| Density | 1.248g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-3-phenyl-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Exact Mass | 202.07400 |
| PSA | 54.86000 |
| LogP | 0.83420 |
| Index of Refraction | 1.586 |
| InChIKey | UOSBFFLSIMXMEM-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)n(-c2ccccc2)c(=O)[nH]1 |
|
~%
6-methyl-3-phen... CAS#:1804-04-2 |
| Literature: Behrend; Meyer,F.C. Chemische Berichte, 1900 , vol. 33, p. 622 |
|
~%
6-methyl-3-phen... CAS#:1804-04-2 |
| Literature: Lacey Journal of the Chemical Society, 1954 , p. 854,859 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3H)-Pyrimidinedione,6-methyl-3-phenyl |
| 6-Methyl-3-phenyl-1H-pyrimidin-2,4-dion |
| 4-Methyl-1-phenyluracil |
| Uracil,6-methyl-3-phenyl |
| 6-Methyl-3-phenyluracil |