3-Nitro-2,5-bis(trifluoromethyl)pyridine
Modify Date: 2026-07-11 19:14:39
3-Nitro-2,5-bis(trifluoromethyl)pyridine structure
|
Common Name | 3-Nitro-2,5-bis(trifluoromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 1804142-98-0 | Molecular Weight | 260.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2F6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Nitro-2,5-bis(trifluoromethyl)pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H2F6N2O2 |
|---|---|
| Molecular Weight | 260.09 |
| InChIKey | HEKZMPXEDDCQFN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cnc1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Nitro-2,5-bis(trifluoromethyl)pyridine? |
| A: Molecular formula of 3-Nitro-2,5-bis(trifluoromethyl)pyridine is C7H2F6N2O2. |
| Q: What is the CAS number of 3-Nitro-2,5-bis(trifluoromethyl)pyridine? |
| A: CAS number of 3-Nitro-2,5-bis(trifluoromethyl)pyridine is 1804142-98-0. |
| Q: What is the Chinese name of 1804142-98-0? |
| A: Chinese name of 1804142-98-0 is 1804142-98-0. |
| Q: What is the molecular weight of 3-Nitro-2,5-bis(trifluoromethyl)pyridine? |
| A: Molecular weight of 3-Nitro-2,5-bis(trifluoromethyl)pyridine is 260.09. |
| Q: What is the SMILES notation of 3-Nitro-2,5-bis(trifluoromethyl)pyridine? |
| A: SMILES notation of 3-Nitro-2,5-bis(trifluoromethyl)pyridine is O=[N+]([O-])c1cc(C(F)(F)F)cnc1C(F)(F)F. |
| Q: What is the InChIKey of 3-Nitro-2,5-bis(trifluoromethyl)pyridine? |
| A: InChIKey of 3-Nitro-2,5-bis(trifluoromethyl)pyridine is HEKZMPXEDDCQFN-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Nitro-2,5-bis(trifluoromethyl)pyridine? |
| A: The English name of 3-Nitro-2,5-bis(trifluoromethyl)pyridine is 3-Nitro-2,5-bis(trifluoromethyl)pyridine. |