dichloro-cyclohexyl-phenylsilane structure
|
Common Name | dichloro-cyclohexyl-phenylsilane | ||
|---|---|---|---|---|
| CAS Number | 18042-67-6 | Molecular Weight | 259.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16Cl2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dichloro-cyclohexyl-phenylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16Cl2Si |
|---|---|
| Molecular Weight | 259.24700 |
| Exact Mass | 258.04000 |
| LogP | 4.14770 |
| InChIKey | MYLMAKOOHNYUAS-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(c1ccccc1)C1CCCCC1 |
|
~82%
dichloro-cycloh... CAS#:18042-67-6 |
| Literature: Homsi, Fadi; Hosoi, Kazushi; Nozaki, Kyoko; Hiyama, Tamejiro Journal of Organometallic Chemistry, 2001 , vol. 624, # 1-2 p. 208 - 216 |
|
~%
dichloro-cycloh... CAS#:18042-67-6 |
| Literature: Cusa; Kipping Journal of the Chemical Society, 1932 , p. 2205,2207,2208 |
| dichloro-cyclohexyl-phenyl-silane |
| Silane,dichlorocyclohexylphenyl |
| Dichlor-cyclohexylphenylsilan |
| dichlorocyclohexylphenylsilan |