3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone
Modify Date: 2025-09-09 16:51:25
3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone structure
|
Common Name | 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 1804384-44-8 | Molecular Weight | 301.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5BrClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5BrClF3O |
|---|---|
| Molecular Weight | 301.49 |
| InChIKey | ZYOUETROUYIMFX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Cl)c(C(F)(F)F)c(Br)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone? |
| A: CAS number of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone is 1804384-44-8. |
| Q: What is the English name of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone? |
| A: The English name of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone is 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone. |
| Q: What is the Chinese name of 1804384-44-8? |
| A: Chinese name of 1804384-44-8 is 1804384-44-8. |
| Q: What is the molecular formula of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone? |
| A: Molecular formula of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone is C9H5BrClF3O. |
| Q: What is the InChIKey of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone? |
| A: InChIKey of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone is ZYOUETROUYIMFX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone? |
| A: SMILES notation of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone is CC(=O)c1cc(Cl)c(C(F)(F)F)c(Br)c1. |
| Q: What is the molecular weight of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone? |
| A: Molecular weight of 3'-Bromo-5'-chloro-4'-(trifluoromethyl)acetophenone is 301.49. |