2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine
Modify Date: 2026-08-19 18:44:51
2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine structure
|
Common Name | 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 1804715-66-9 | Molecular Weight | 335.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4Br2ClF2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H4Br2ClF2N |
|---|---|
| Molecular Weight | 335.37 |
| InChIKey | QVNJLIAWMQOODS-UHFFFAOYSA-N |
| SMILES | FC(F)c1c(CCl)ncc(Br)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine? |
| A: SMILES notation of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine is FC(F)c1c(CCl)ncc(Br)c1Br. |
| Q: What is the CAS number of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine? |
| A: CAS number of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine is 1804715-66-9. |
| Q: What is the InChIKey of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine? |
| A: InChIKey of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine is QVNJLIAWMQOODS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1804715-66-9? |
| A: Chinese name of 1804715-66-9 is 1804715-66-9. |
| Q: What is the molecular formula of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine? |
| A: Molecular formula of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine is C7H4Br2ClF2N. |
| Q: What is the molecular weight of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine? |
| A: Molecular weight of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine is 335.37. |
| Q: What is the English name of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine? |
| A: The English name of 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine is 2-(Chloromethyl)-4,5-dibromo-3-(difluoromethyl)pyridine. |