2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol structure
|
Common Name | 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 1804875-94-2 | Molecular Weight | 331.94 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6Br2F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6Br2F2O2 |
|---|---|
| Molecular Weight | 331.94 |
| InChIKey | IMEAHQWVWYGACP-UHFFFAOYSA-N |
| SMILES | OCc1cc(OC(F)F)cc(Br)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol? |
| A: Molecular weight of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol is 331.94. |
| Q: What is the CAS number of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol? |
| A: CAS number of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol is 1804875-94-2. |
| Q: What is the molecular formula of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol? |
| A: Molecular formula of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol is C8H6Br2F2O2. |
| Q: What is the English name of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol? |
| A: The English name of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol is 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol. |
| Q: What is the SMILES notation of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol? |
| A: SMILES notation of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol is OCc1cc(OC(F)F)cc(Br)c1Br. |
| Q: What is the InChIKey of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol? |
| A: InChIKey of 2,3-Dibromo-5-(difluoromethoxy)benzyl alcohol is IMEAHQWVWYGACP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1804875-94-2? |
| A: Chinese name of 1804875-94-2 is 1804875-94-2. |