Ethyl 2-bromo-3,5-difluorobenzoate
Modify Date: 2026-07-12 19:31:50
Ethyl 2-bromo-3,5-difluorobenzoate structure
|
Common Name | Ethyl 2-bromo-3,5-difluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1804909-80-5 | Molecular Weight | 265.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrF2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-bromo-3,5-difluorobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7BrF2O2 |
|---|---|
| Molecular Weight | 265.05 |
| InChIKey | WCPFQAXPUUPDET-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(F)cc(F)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1804909-80-5? |
| A: Chinese name of 1804909-80-5 is 1804909-80-5. |
| Q: What is the molecular formula of Ethyl 2-bromo-3,5-difluorobenzoate? |
| A: Molecular formula of Ethyl 2-bromo-3,5-difluorobenzoate is C9H7BrF2O2. |
| Q: What is the molecular weight of Ethyl 2-bromo-3,5-difluorobenzoate? |
| A: Molecular weight of Ethyl 2-bromo-3,5-difluorobenzoate is 265.05. |
| Q: What is the CAS number of Ethyl 2-bromo-3,5-difluorobenzoate? |
| A: CAS number of Ethyl 2-bromo-3,5-difluorobenzoate is 1804909-80-5. |
| Q: What is the English name of Ethyl 2-bromo-3,5-difluorobenzoate? |
| A: The English name of Ethyl 2-bromo-3,5-difluorobenzoate is Ethyl 2-bromo-3,5-difluorobenzoate. |
| Q: What is the InChIKey of Ethyl 2-bromo-3,5-difluorobenzoate? |
| A: InChIKey of Ethyl 2-bromo-3,5-difluorobenzoate is WCPFQAXPUUPDET-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Ethyl 2-bromo-3,5-difluorobenzoate? |
| A: SMILES notation of Ethyl 2-bromo-3,5-difluorobenzoate is CCOC(=O)c1cc(F)cc(F)c1Br. |