1,3,8,9-tetramethoxy-[1]benzofuro[3,2-c]chromen-6-one structure
|
Common Name | 1,3,8,9-tetramethoxy-[1]benzofuro[3,2-c]chromen-6-one | ||
|---|---|---|---|---|
| CAS Number | 1805-77-2 | Molecular Weight | 356.32600 | |
| Density | 1.336g/cm3 | Boiling Point | 539.3ºC at 760 mmHg | |
| Molecular Formula | C19H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.9ºC | |
| Name | 1,3,8,9-tetramethoxy-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 539.3ºC at 760 mmHg |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.32600 |
| Flash Point | 279.9ºC |
| Exact Mass | 356.09000 |
| PSA | 80.27000 |
| LogP | 3.72680 |
| Vapour Pressure | 1.07E-11mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | TVSXWGONJFTDHC-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(c1)oc(=O)c1c3cc(OC)c(OC)cc3oc21 |
|
~67%
1,3,8,9-tetrame... CAS#:1805-77-2 |
| Literature: Liu, Yingjie; Liu, Jingxin; Wang, Mang; Liu, Jun; Liu, Qun Advanced Synthesis and Catalysis, 2012 , vol. 354, # 14-15 p. 2678 - 2682 |
|
~%
1,3,8,9-tetrame... CAS#:1805-77-2 |
| Literature: Bowyer et al. Journal of the Chemical Society, 1957 , p. 542 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3,8,9-tetramethoxy-benzofuro[3,2-c]chromen-6-one |
| 1,3,8,9-tetramethoxy-6H-benzofuro[3,2-c]chromen-6-one |
| Tri-O-methyl-wedelo-lacton |
| 1,3,8,9-Tetramethoxy-benzofuro[3,2-c]chromen-6-on |
| tri-O-methylwedelolactone |
| Tri-O-methyl-wendelolacton |
| 4,2'-epoxy-5,7,4',5'-tetramethoxy-3-phenylcoumarin |