Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl)
Modify Date: 2025-09-19 15:43:00
Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl) structure
|
Common Name | Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 1805213-03-9 | Molecular Weight | 287.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H3F6NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H3F6NO3 |
|---|---|
| Molecular Weight | 287.11 |
| InChIKey | LOFRECOIHAXULY-UHFFFAOYSA-N |
| SMILES | O=Cc1cc([N+](=O)[O-])cc(C(F)(F)F)c1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl)? |
| A: The English name of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl) is Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl). |
| Q: What is the CAS number of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl)? |
| A: CAS number of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl) is 1805213-03-9. |
| Q: What is the InChIKey of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl)? |
| A: InChIKey of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl) is LOFRECOIHAXULY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl)? |
| A: Molecular weight of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl) is 287.11. |
| Q: What is the Chinese name of 1805213-03-9? |
| A: Chinese name of 1805213-03-9 is 1805213-03-9. |
| Q: What is the molecular formula of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl)? |
| A: Molecular formula of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl) is C9H3F6NO3. |
| Q: What is the SMILES notation of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl)? |
| A: SMILES notation of Benzaldehyde, 5-nitro-2,3-bis(trifluoromethyl) is O=Cc1cc([N+](=O)[O-])cc(C(F)(F)F)c1C(F)(F)F. |