Methyl 5-(chloromethyl)-2,3-difluorobenzoate
Modify Date: 2025-09-06 21:36:55
Methyl 5-(chloromethyl)-2,3-difluorobenzoate structure
|
Common Name | Methyl 5-(chloromethyl)-2,3-difluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1805237-81-3 | Molecular Weight | 220.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7ClF2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5-(chloromethyl)-2,3-difluorobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7ClF2O2 |
|---|---|
| Molecular Weight | 220.60 |
| InChIKey | VHDRAFFBZAZAIX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(CCl)cc(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1805237-81-3? |
| A: Chinese name of 1805237-81-3 is 1805237-81-3. |
| Q: What is the molecular weight of Methyl 5-(chloromethyl)-2,3-difluorobenzoate? |
| A: Molecular weight of Methyl 5-(chloromethyl)-2,3-difluorobenzoate is 220.60. |
| Q: What is the CAS number of Methyl 5-(chloromethyl)-2,3-difluorobenzoate? |
| A: CAS number of Methyl 5-(chloromethyl)-2,3-difluorobenzoate is 1805237-81-3. |
| Q: What is the SMILES notation of Methyl 5-(chloromethyl)-2,3-difluorobenzoate? |
| A: SMILES notation of Methyl 5-(chloromethyl)-2,3-difluorobenzoate is COC(=O)c1cc(CCl)cc(F)c1F. |
| Q: What is the English name of Methyl 5-(chloromethyl)-2,3-difluorobenzoate? |
| A: The English name of Methyl 5-(chloromethyl)-2,3-difluorobenzoate is Methyl 5-(chloromethyl)-2,3-difluorobenzoate. |
| Q: What is the InChIKey of Methyl 5-(chloromethyl)-2,3-difluorobenzoate? |
| A: InChIKey of Methyl 5-(chloromethyl)-2,3-difluorobenzoate is VHDRAFFBZAZAIX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 5-(chloromethyl)-2,3-difluorobenzoate? |
| A: Molecular formula of Methyl 5-(chloromethyl)-2,3-difluorobenzoate is C9H7ClF2O2. |