4,6-Dibromo-5-(difluoromethyl)nicotinic acid
Modify Date: 2026-08-19 18:28:07
4,6-Dibromo-5-(difluoromethyl)nicotinic acid structure
|
Common Name | 4,6-Dibromo-5-(difluoromethyl)nicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 1805245-08-2 | Molecular Weight | 330.91 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Br2F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-Dibromo-5-(difluoromethyl)nicotinic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3Br2F2NO2 |
|---|---|
| Molecular Weight | 330.91 |
| InChIKey | NOOQETJYUDAXDI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cnc(Br)c(C(F)F)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid? |
| A: Molecular formula of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid is C7H3Br2F2NO2. |
| Q: What is the SMILES notation of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid? |
| A: SMILES notation of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid is O=C(O)c1cnc(Br)c(C(F)F)c1Br. |
| Q: What is the molecular weight of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid? |
| A: Molecular weight of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid is 330.91. |
| Q: What is the Chinese name of 1805245-08-2? |
| A: Chinese name of 1805245-08-2 is 1805245-08-2. |
| Q: What is the English name of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid? |
| A: The English name of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid is 4,6-Dibromo-5-(difluoromethyl)nicotinic acid. |
| Q: What is the InChIKey of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid? |
| A: InChIKey of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid is NOOQETJYUDAXDI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid? |
| A: CAS number of 4,6-Dibromo-5-(difluoromethyl)nicotinic acid is 1805245-08-2. |