2,4,5-Trichloro-3-(trifluoromethoxy)pyridine
Modify Date: 2026-07-16 08:07:19
2,4,5-Trichloro-3-(trifluoromethoxy)pyridine structure
|
Common Name | 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine | ||
|---|---|---|---|---|
| CAS Number | 1805309-53-8 | Molecular Weight | 266.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6HCl3F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6HCl3F3NO |
|---|---|
| Molecular Weight | 266.4 |
| InChIKey | ARNWIMJUYYNXEH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1c(Cl)ncc(Cl)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine? |
| A: Molecular formula of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine is C6HCl3F3NO. |
| Q: What is the CAS number of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine? |
| A: CAS number of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine is 1805309-53-8. |
| Q: What is the SMILES notation of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine? |
| A: SMILES notation of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine is FC(F)(F)Oc1c(Cl)ncc(Cl)c1Cl. |
| Q: What is the InChIKey of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine? |
| A: InChIKey of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine is ARNWIMJUYYNXEH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine? |
| A: Molecular weight of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine is 266.4. |
| Q: What is the English name of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine? |
| A: The English name of 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine is 2,4,5-Trichloro-3-(trifluoromethoxy)pyridine. |
| Q: What is the Chinese name of 1805309-53-8? |
| A: Chinese name of 1805309-53-8 is 1805309-53-8. |