3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine
Modify Date: 2026-07-02 18:12:09
3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine structure
|
Common Name | 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 1805321-18-9 | Molecular Weight | 227.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6F5N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H6F5N3 |
|---|---|
| Molecular Weight | 227.13 |
| InChIKey | ODUSIHPUNRHPIK-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c(C(F)(F)F)cc1C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine? |
| A: Molecular weight of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine is 227.13. |
| Q: What is the English name of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine? |
| A: The English name of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine is 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine. |
| Q: What is the SMILES notation of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine? |
| A: SMILES notation of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine is Nc1nc(N)c(C(F)(F)F)cc1C(F)F. |
| Q: What is the InChIKey of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine? |
| A: InChIKey of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine is ODUSIHPUNRHPIK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1805321-18-9? |
| A: Chinese name of 1805321-18-9 is 1805321-18-9. |
| Q: What is the molecular formula of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine? |
| A: Molecular formula of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine is C7H6F5N3. |
| Q: What is the CAS number of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine? |
| A: CAS number of 3-(Difluoromethyl)-5-(trifluoromethyl)pyridine-2,6-diamine is 1805321-18-9. |