Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl)
Modify Date: 2026-07-21 19:45:04
Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl) structure
|
Common Name | Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 1805591-01-8 | Molecular Weight | 335.04 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5BrF6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5BrF6O |
|---|---|
| Molecular Weight | 335.04 |
| InChIKey | GSROZXOMKSYNNE-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(CBr)c(C(F)(F)F)cc1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl)? |
| A: The English name of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl) is Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl). |
| Q: What is the SMILES notation of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl)? |
| A: SMILES notation of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl) is O=Cc1cc(CBr)c(C(F)(F)F)cc1C(F)(F)F. |
| Q: What is the CAS number of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl)? |
| A: CAS number of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl) is 1805591-01-8. |
| Q: What is the molecular weight of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl)? |
| A: Molecular weight of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl) is 335.04. |
| Q: What is the molecular formula of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl)? |
| A: Molecular formula of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl) is C10H5BrF6O. |
| Q: What is the InChIKey of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl)? |
| A: InChIKey of Benzaldehyde, 5-(bromomethyl)-2,4-bis(trifluoromethyl) is GSROZXOMKSYNNE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1805591-01-8? |
| A: Chinese name of 1805591-01-8 is 1805591-01-8. |