1,4-BIS-(4-CHLOROPHENOXY)-2-BUTENE structure
|
Common Name | 1,4-BIS-(4-CHLOROPHENOXY)-2-BUTENE | ||
|---|---|---|---|---|
| CAS Number | 18059-53-5 | Molecular Weight | 309.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-[4-(4-chlorophenoxy)but-2-enoxy]benzene |
|---|
| Molecular Formula | C16H14Cl2O2 |
|---|---|
| Molecular Weight | 309.18700 |
| Exact Mass | 308.03700 |
| PSA | 18.46000 |
| LogP | 5.00740 |
| Index of Refraction | 1.581 |
| InChIKey | CTLVUWCSVANYOV-UHFFFAOYSA-N |
| SMILES | Clc1ccc(OCC=CCOc2ccc(Cl)cc2)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |