(4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine
Modify Date: 2026-07-01 19:47:36
(4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine structure
|
Common Name | (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 1806271-23-7 | Molecular Weight | 330.95 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7Br2F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7Br2F2NO |
|---|---|
| Molecular Weight | 330.95 |
| InChIKey | ZNIMXAHKGMZRSV-UHFFFAOYSA-N |
| SMILES | NCc1cc(Br)c(Br)cc1OC(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine? |
| A: Molecular weight of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine is 330.95. |
| Q: What is the Chinese name of 1806271-23-7? |
| A: Chinese name of 1806271-23-7 is 1806271-23-7. |
| Q: What is the InChIKey of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine? |
| A: InChIKey of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine is ZNIMXAHKGMZRSV-UHFFFAOYSA-N. |
| Q: What is the English name of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine? |
| A: The English name of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine is (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine. |
| Q: What is the SMILES notation of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine? |
| A: SMILES notation of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine is NCc1cc(Br)c(Br)cc1OC(F)F. |
| Q: What is the CAS number of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine? |
| A: CAS number of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine is 1806271-23-7. |
| Q: What is the molecular formula of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine? |
| A: Molecular formula of (4,5-Dibromo-2-(difluoromethoxy)phenyl)methanamine is C8H7Br2F2NO. |