(2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane
Modify Date: 2025-09-07 17:40:56
(2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane structure
|
Common Name | (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane | ||
|---|---|---|---|---|
| CAS Number | 1806305-13-4 | Molecular Weight | 348.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6Br2F2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6Br2F2OS |
|---|---|
| Molecular Weight | 348.00 |
| InChIKey | JPDMDWLTVAITBE-UHFFFAOYSA-N |
| SMILES | CSc1cc(OC(F)F)cc(Br)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1806305-13-4? |
| A: Chinese name of 1806305-13-4 is 1806305-13-4. |
| Q: What is the molecular weight of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane? |
| A: Molecular weight of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane is 348.00. |
| Q: What is the InChIKey of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane? |
| A: InChIKey of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane is JPDMDWLTVAITBE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane? |
| A: Molecular formula of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane is C8H6Br2F2OS. |
| Q: What is the SMILES notation of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane? |
| A: SMILES notation of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane is CSc1cc(OC(F)F)cc(Br)c1Br. |
| Q: What is the English name of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane? |
| A: The English name of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane is (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane. |
| Q: What is the CAS number of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane? |
| A: CAS number of (2,3-Dibromo-5-(difluoromethoxy)phenyl)(methyl)sulfane is 1806305-13-4. |