2,6-Dibromo-3,5-difluorophenylacetonitrile
Modify Date: 2026-07-14 10:41:35
2,6-Dibromo-3,5-difluorophenylacetonitrile structure
|
Common Name | 2,6-Dibromo-3,5-difluorophenylacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 1806306-17-1 | Molecular Weight | 310.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3Br2F2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-Dibromo-3,5-difluorophenylacetonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H3Br2F2N |
|---|---|
| Molecular Weight | 310.92 |
| InChIKey | UQRQRXPSKIPIOD-UHFFFAOYSA-N |
| SMILES | N#CCc1c(Br)c(F)cc(F)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1806306-17-1? |
| A: Chinese name of 1806306-17-1 is 1806306-17-1. |
| Q: What is the InChIKey of 2,6-Dibromo-3,5-difluorophenylacetonitrile? |
| A: InChIKey of 2,6-Dibromo-3,5-difluorophenylacetonitrile is UQRQRXPSKIPIOD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,6-Dibromo-3,5-difluorophenylacetonitrile? |
| A: Molecular formula of 2,6-Dibromo-3,5-difluorophenylacetonitrile is C8H3Br2F2N. |
| Q: What is the SMILES notation of 2,6-Dibromo-3,5-difluorophenylacetonitrile? |
| A: SMILES notation of 2,6-Dibromo-3,5-difluorophenylacetonitrile is N#CCc1c(Br)c(F)cc(F)c1Br. |
| Q: What is the molecular weight of 2,6-Dibromo-3,5-difluorophenylacetonitrile? |
| A: Molecular weight of 2,6-Dibromo-3,5-difluorophenylacetonitrile is 310.92. |
| Q: What is the CAS number of 2,6-Dibromo-3,5-difluorophenylacetonitrile? |
| A: CAS number of 2,6-Dibromo-3,5-difluorophenylacetonitrile is 1806306-17-1. |
| Q: What is the English name of 2,6-Dibromo-3,5-difluorophenylacetonitrile? |
| A: The English name of 2,6-Dibromo-3,5-difluorophenylacetonitrile is 2,6-Dibromo-3,5-difluorophenylacetonitrile. |