2,3-Dibromo-5,6-difluorophenylacetonitrile
Modify Date: 2026-07-03 10:31:17
2,3-Dibromo-5,6-difluorophenylacetonitrile structure
|
Common Name | 2,3-Dibromo-5,6-difluorophenylacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 1806327-01-4 | Molecular Weight | 310.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3Br2F2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dibromo-5,6-difluorophenylacetonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H3Br2F2N |
|---|---|
| Molecular Weight | 310.92 |
| InChIKey | JUEXJMROKTUZES-UHFFFAOYSA-N |
| SMILES | N#CCc1c(F)c(F)cc(Br)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,3-Dibromo-5,6-difluorophenylacetonitrile? |
| A: CAS number of 2,3-Dibromo-5,6-difluorophenylacetonitrile is 1806327-01-4. |
| Q: What is the molecular formula of 2,3-Dibromo-5,6-difluorophenylacetonitrile? |
| A: Molecular formula of 2,3-Dibromo-5,6-difluorophenylacetonitrile is C8H3Br2F2N. |
| Q: What is the Chinese name of 1806327-01-4? |
| A: Chinese name of 1806327-01-4 is 1806327-01-4. |
| Q: What is the InChIKey of 2,3-Dibromo-5,6-difluorophenylacetonitrile? |
| A: InChIKey of 2,3-Dibromo-5,6-difluorophenylacetonitrile is JUEXJMROKTUZES-UHFFFAOYSA-N. |
| Q: What is the English name of 2,3-Dibromo-5,6-difluorophenylacetonitrile? |
| A: The English name of 2,3-Dibromo-5,6-difluorophenylacetonitrile is 2,3-Dibromo-5,6-difluorophenylacetonitrile. |
| Q: What is the SMILES notation of 2,3-Dibromo-5,6-difluorophenylacetonitrile? |
| A: SMILES notation of 2,3-Dibromo-5,6-difluorophenylacetonitrile is N#CCc1c(F)c(F)cc(Br)c1Br. |
| Q: What is the molecular weight of 2,3-Dibromo-5,6-difluorophenylacetonitrile? |
| A: Molecular weight of 2,3-Dibromo-5,6-difluorophenylacetonitrile is 310.92. |