Ethyl 4,6-dibromopicolinate structure
|
Common Name | Ethyl 4,6-dibromopicolinate | ||
|---|---|---|---|---|
| CAS Number | 1806348-02-6 | Molecular Weight | 308.95 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 4,6-dibromopicolinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7Br2NO2 |
|---|---|
| Molecular Weight | 308.95 |
| InChIKey | YTBSIJSYIYKXKV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Br)cc(Br)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1806348-02-6? |
| A: Chinese name of 1806348-02-6 is 1806348-02-6. |
| Q: What is the SMILES notation of Ethyl 4,6-dibromopicolinate? |
| A: SMILES notation of Ethyl 4,6-dibromopicolinate is CCOC(=O)c1cc(Br)cc(Br)n1. |
| Q: What is the InChIKey of Ethyl 4,6-dibromopicolinate? |
| A: InChIKey of Ethyl 4,6-dibromopicolinate is YTBSIJSYIYKXKV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Ethyl 4,6-dibromopicolinate? |
| A: Molecular weight of Ethyl 4,6-dibromopicolinate is 308.95. |
| Q: What is the English name of Ethyl 4,6-dibromopicolinate? |
| A: The English name of Ethyl 4,6-dibromopicolinate is Ethyl 4,6-dibromopicolinate. |
| Q: What is the CAS number of Ethyl 4,6-dibromopicolinate? |
| A: CAS number of Ethyl 4,6-dibromopicolinate is 1806348-02-6. |
| Q: What is the molecular formula of Ethyl 4,6-dibromopicolinate? |
| A: Molecular formula of Ethyl 4,6-dibromopicolinate is C8H7Br2NO2. |