Benzenamine, 3,4-dibromo-2-(trifluoromethyl)
Modify Date: 2026-07-16 20:16:08
Benzenamine, 3,4-dibromo-2-(trifluoromethyl) structure
|
Common Name | Benzenamine, 3,4-dibromo-2-(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 1806348-11-7 | Molecular Weight | 318.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4Br2F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenamine, 3,4-dibromo-2-(trifluoromethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H4Br2F3N |
|---|---|
| Molecular Weight | 318.92 |
| InChIKey | BREYNDRMVXIDMN-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Br)c(Br)c1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Benzenamine, 3,4-dibromo-2-(trifluoromethyl)? |
| A: CAS number of Benzenamine, 3,4-dibromo-2-(trifluoromethyl) is 1806348-11-7. |
| Q: What is the InChIKey of Benzenamine, 3,4-dibromo-2-(trifluoromethyl)? |
| A: InChIKey of Benzenamine, 3,4-dibromo-2-(trifluoromethyl) is BREYNDRMVXIDMN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Benzenamine, 3,4-dibromo-2-(trifluoromethyl)? |
| A: SMILES notation of Benzenamine, 3,4-dibromo-2-(trifluoromethyl) is Nc1ccc(Br)c(Br)c1C(F)(F)F. |
| Q: What is the English name of Benzenamine, 3,4-dibromo-2-(trifluoromethyl)? |
| A: The English name of Benzenamine, 3,4-dibromo-2-(trifluoromethyl) is Benzenamine, 3,4-dibromo-2-(trifluoromethyl). |
| Q: What is the molecular formula of Benzenamine, 3,4-dibromo-2-(trifluoromethyl)? |
| A: Molecular formula of Benzenamine, 3,4-dibromo-2-(trifluoromethyl) is C7H4Br2F3N. |
| Q: What is the molecular weight of Benzenamine, 3,4-dibromo-2-(trifluoromethyl)? |
| A: Molecular weight of Benzenamine, 3,4-dibromo-2-(trifluoromethyl) is 318.92. |
| Q: What is the Chinese name of 1806348-11-7? |
| A: Chinese name of 1806348-11-7 is 1806348-11-7. |