Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl)
Modify Date: 2026-09-27 12:06:36
Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl) structure
|
Common Name | Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl) | ||
|---|---|---|---|---|
| CAS Number | 1806348-18-4 | Molecular Weight | 316.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7Br2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7Br2NO |
|---|---|
| Molecular Weight | 316.98 |
| InChIKey | XQZKQYWJQJWUOL-UHFFFAOYSA-N |
| SMILES | N#Cc1cccc(C(=O)CCBr)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl)? |
| A: CAS number of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl) is 1806348-18-4. |
| Q: What is the molecular formula of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl)? |
| A: Molecular formula of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl) is C10H7Br2NO. |
| Q: What is the molecular weight of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl)? |
| A: Molecular weight of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl) is 316.98. |
| Q: What is the SMILES notation of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl)? |
| A: SMILES notation of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl) is N#Cc1cccc(C(=O)CCBr)c1Br. |
| Q: What is the Chinese name of 1806348-18-4? |
| A: Chinese name of 1806348-18-4 is 1806348-18-4. |
| Q: What is the English name of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl)? |
| A: The English name of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl) is Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl). |
| Q: What is the InChIKey of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl)? |
| A: InChIKey of Benzonitrile, 2-bromo-3-(3-bromo-1-oxopropyl) is XQZKQYWJQJWUOL-UHFFFAOYSA-N. |