2',3'-Dichloro-5'-(difluoromethoxy)acetophenone
Modify Date: 2026-08-26 14:40:43
2',3'-Dichloro-5'-(difluoromethoxy)acetophenone structure
|
Common Name | 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 1806348-29-7 | Molecular Weight | 255.04 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6Cl2F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6Cl2F2O2 |
|---|---|
| Molecular Weight | 255.04 |
| InChIKey | GUFNGJQNOYWTTP-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(OC(F)F)cc(Cl)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1806348-29-7? |
| A: Chinese name of 1806348-29-7 is 1806348-29-7. |
| Q: What is the molecular formula of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone? |
| A: Molecular formula of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone is C9H6Cl2F2O2. |
| Q: What is the InChIKey of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone? |
| A: InChIKey of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone is GUFNGJQNOYWTTP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone? |
| A: SMILES notation of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone is CC(=O)c1cc(OC(F)F)cc(Cl)c1Cl. |
| Q: What is the English name of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone? |
| A: The English name of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone is 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone. |
| Q: What is the CAS number of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone? |
| A: CAS number of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone is 1806348-29-7. |
| Q: What is the molecular weight of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone? |
| A: Molecular weight of 2',3'-Dichloro-5'-(difluoromethoxy)acetophenone is 255.04. |