Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy)
Modify Date: 2026-08-11 11:51:58
Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy) structure
|
Common Name | Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy) | ||
|---|---|---|---|---|
| CAS Number | 1806348-46-8 | Molecular Weight | 431.89 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2F4I2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H2F4I2O |
|---|---|
| Molecular Weight | 431.89 |
| InChIKey | AOSWVGYJHLISGH-UHFFFAOYSA-N |
| SMILES | Fc1c(I)ccc(I)c1OC(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy)? |
| A: InChIKey of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy) is AOSWVGYJHLISGH-UHFFFAOYSA-N. |
| Q: What is the CAS number of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy)? |
| A: CAS number of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy) is 1806348-46-8. |
| Q: What is the English name of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy)? |
| A: The English name of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy) is Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy). |
| Q: What is the SMILES notation of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy)? |
| A: SMILES notation of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy) is Fc1c(I)ccc(I)c1OC(F)(F)F. |
| Q: What is the Chinese name of 1806348-46-8? |
| A: Chinese name of 1806348-46-8 is 1806348-46-8. |
| Q: What is the molecular weight of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy)? |
| A: Molecular weight of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy) is 431.89. |
| Q: What is the molecular formula of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy)? |
| A: Molecular formula of Benzene, 2-fluoro-1,4-diiodo-3-(trifluoromethoxy) is C7H2F4I2O. |