3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride
Modify Date: 2025-09-09 20:19:11
3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride structure
|
Common Name | 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 1806352-78-2 | Molecular Weight | 281.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3Cl2F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H3Cl2F5O |
|---|---|
| Molecular Weight | 281.00 |
| InChIKey | AGSWYRJNTFTLSR-UHFFFAOYSA-N |
| SMILES | FC(F)Oc1c(Cl)cc(C(F)(F)F)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride? |
| A: The English name of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride is 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride. |
| Q: What is the Chinese name of 1806352-78-2? |
| A: Chinese name of 1806352-78-2 is 1806352-78-2. |
| Q: What is the SMILES notation of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride? |
| A: SMILES notation of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride is FC(F)Oc1c(Cl)cc(C(F)(F)F)cc1Cl. |
| Q: What is the molecular formula of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride? |
| A: Molecular formula of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride is C8H3Cl2F5O. |
| Q: What is the molecular weight of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride? |
| A: Molecular weight of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride is 281.00. |
| Q: What is the InChIKey of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride? |
| A: InChIKey of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride is AGSWYRJNTFTLSR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride? |
| A: CAS number of 3,5-Dichloro-4-(difluoromethoxy)benzotrifluoride is 1806352-78-2. |