Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl]
Modify Date: 2026-09-28 00:06:00
![Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] Structure](https://www.chemsrc.com/extcaspic/413/1806355-02-1.png)
Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] structure
|
Common Name | Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 1806355-02-1 | Molecular Weight | 247.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12F3NO2 |
|---|---|
| Molecular Weight | 247.21 |
| InChIKey | OXILUZFFYFGYAT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(N(C)C)cc1OC(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl]? |
| A: The English name of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] is Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl]. |
| Q: What is the molecular formula of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl]? |
| A: Molecular formula of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] is C11H12F3NO2. |
| Q: What is the CAS number of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl]? |
| A: CAS number of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] is 1806355-02-1. |
| Q: What is the SMILES notation of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl]? |
| A: SMILES notation of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] is CC(=O)c1ccc(N(C)C)cc1OC(F)(F)F. |
| Q: What is the Chinese name of 1806355-02-1? |
| A: Chinese name of 1806355-02-1 is 1806355-02-1. |
| Q: What is the molecular weight of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl]? |
| A: Molecular weight of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] is 247.21. |
| Q: What is the InChIKey of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl]? |
| A: InChIKey of Ethanone, 1-[4-(dimethylamino)-2-(trifluoromethoxy)phenyl] is OXILUZFFYFGYAT-UHFFFAOYSA-N. |