1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene
Modify Date: 2026-07-07 19:33:26
1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene structure
|
Common Name | 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene | ||
|---|---|---|---|---|
| CAS Number | 1806357-18-5 | Molecular Weight | 301.04 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7Cl2F6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7Cl2F6S |
|---|---|
| Molecular Weight | 301.04 |
| InChIKey | NUEFFXYSCWXISU-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(Cl)c(SC(F)(F)F)c(Cl)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene? |
| A: Molecular formula of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene is C7Cl2F6S. |
| Q: What is the InChIKey of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene? |
| A: InChIKey of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene is NUEFFXYSCWXISU-UHFFFAOYSA-N. |
| Q: What is the English name of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene? |
| A: The English name of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene is 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene. |
| Q: What is the CAS number of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene? |
| A: CAS number of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene is 1806357-18-5. |
| Q: What is the Chinese name of 1806357-18-5? |
| A: Chinese name of 1806357-18-5 is 1806357-18-5. |
| Q: What is the SMILES notation of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene? |
| A: SMILES notation of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene is Fc1c(F)c(Cl)c(SC(F)(F)F)c(Cl)c1F. |
| Q: What is the molecular weight of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene? |
| A: Molecular weight of 1,3-Dichloro-4,5,6-trifluoro-2-(trifluoromethylthio)benzene is 301.04. |