5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride
Modify Date: 2026-07-27 23:38:04
5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride structure
|
Common Name | 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1806357-22-1 | Molecular Weight | 278.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3ClF4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3ClF4O3S |
|---|---|
| Molecular Weight | 278.61 |
| InChIKey | GGJNQOLZWWLOJK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cc(OC(F)F)c(F)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride? |
| A: SMILES notation of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride is O=S(=O)(Cl)c1cc(OC(F)F)c(F)cc1F. |
| Q: What is the molecular weight of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride? |
| A: Molecular weight of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride is 278.61. |
| Q: What is the CAS number of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride? |
| A: CAS number of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride is 1806357-22-1. |
| Q: What is the InChIKey of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride? |
| A: InChIKey of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride is GGJNQOLZWWLOJK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1806357-22-1? |
| A: Chinese name of 1806357-22-1 is 1806357-22-1. |
| Q: What is the English name of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride? |
| A: The English name of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride is 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride. |
| Q: What is the molecular formula of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride? |
| A: Molecular formula of 5-(Difluoromethoxy)-2,4-difluorobenzene-1-sulfonyl chloride is C7H3ClF4O3S. |