Ethyl 2-fluoro-3,4-dimethoxybenzoate
Modify Date: 2025-08-21 15:14:58
Ethyl 2-fluoro-3,4-dimethoxybenzoate structure
|
Common Name | Ethyl 2-fluoro-3,4-dimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 1806390-89-5 | Molecular Weight | 228.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-fluoro-3,4-dimethoxybenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13FO4 |
|---|---|
| Molecular Weight | 228.22 |
| InChIKey | WMRVBBOKSGAWLX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OC)c(OC)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1806390-89-5? |
| A: Chinese name of 1806390-89-5 is 1806390-89-5. |
| Q: What is the InChIKey of Ethyl 2-fluoro-3,4-dimethoxybenzoate? |
| A: InChIKey of Ethyl 2-fluoro-3,4-dimethoxybenzoate is WMRVBBOKSGAWLX-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl 2-fluoro-3,4-dimethoxybenzoate? |
| A: The English name of Ethyl 2-fluoro-3,4-dimethoxybenzoate is Ethyl 2-fluoro-3,4-dimethoxybenzoate. |
| Q: What is the CAS number of Ethyl 2-fluoro-3,4-dimethoxybenzoate? |
| A: CAS number of Ethyl 2-fluoro-3,4-dimethoxybenzoate is 1806390-89-5. |
| Q: What is the SMILES notation of Ethyl 2-fluoro-3,4-dimethoxybenzoate? |
| A: SMILES notation of Ethyl 2-fluoro-3,4-dimethoxybenzoate is CCOC(=O)c1ccc(OC)c(OC)c1F. |
| Q: What is the molecular formula of Ethyl 2-fluoro-3,4-dimethoxybenzoate? |
| A: Molecular formula of Ethyl 2-fluoro-3,4-dimethoxybenzoate is C11H13FO4. |
| Q: What is the molecular weight of Ethyl 2-fluoro-3,4-dimethoxybenzoate? |
| A: Molecular weight of Ethyl 2-fluoro-3,4-dimethoxybenzoate is 228.22. |