4'-Nitro-2'-(trifluoromethoxy)acetanilide
Modify Date: 2026-07-16 20:26:33
4'-Nitro-2'-(trifluoromethoxy)acetanilide structure
|
Common Name | 4'-Nitro-2'-(trifluoromethoxy)acetanilide | ||
|---|---|---|---|---|
| CAS Number | 1806498-28-1 | Molecular Weight | 264.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4'-Nitro-2'-(trifluoromethoxy)acetanilide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7F3N2O4 |
|---|---|
| Molecular Weight | 264.16 |
| InChIKey | CVMBVWXQGBQHQL-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])cc1OC(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4'-Nitro-2'-(trifluoromethoxy)acetanilide? |
| A: Molecular weight of 4'-Nitro-2'-(trifluoromethoxy)acetanilide is 264.16. |
| Q: What is the English name of 4'-Nitro-2'-(trifluoromethoxy)acetanilide? |
| A: The English name of 4'-Nitro-2'-(trifluoromethoxy)acetanilide is 4'-Nitro-2'-(trifluoromethoxy)acetanilide. |
| Q: What is the InChIKey of 4'-Nitro-2'-(trifluoromethoxy)acetanilide? |
| A: InChIKey of 4'-Nitro-2'-(trifluoromethoxy)acetanilide is CVMBVWXQGBQHQL-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4'-Nitro-2'-(trifluoromethoxy)acetanilide? |
| A: SMILES notation of 4'-Nitro-2'-(trifluoromethoxy)acetanilide is CC(=O)Nc1ccc([N+](=O)[O-])cc1OC(F)(F)F. |
| Q: What is the CAS number of 4'-Nitro-2'-(trifluoromethoxy)acetanilide? |
| A: CAS number of 4'-Nitro-2'-(trifluoromethoxy)acetanilide is 1806498-28-1. |
| Q: What is the Chinese name of 1806498-28-1? |
| A: Chinese name of 1806498-28-1 is 1806498-28-1. |
| Q: What is the molecular formula of 4'-Nitro-2'-(trifluoromethoxy)acetanilide? |
| A: Molecular formula of 4'-Nitro-2'-(trifluoromethoxy)acetanilide is C9H7F3N2O4. |