6-(Difluoromethyl)-3-nitropyridine-2,4-diamine
Modify Date: 2026-07-31 13:20:38
6-(Difluoromethyl)-3-nitropyridine-2,4-diamine structure
|
Common Name | 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 1806787-40-5 | Molecular Weight | 204.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6F2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H6F2N4O2 |
|---|---|
| Molecular Weight | 204.13 |
| InChIKey | CNPFWLSPWWRCEZ-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)F)nc(N)c1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine? |
| A: InChIKey of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine is CNPFWLSPWWRCEZ-UHFFFAOYSA-N. |
| Q: What is the English name of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine? |
| A: The English name of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine is 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine. |
| Q: What is the CAS number of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine? |
| A: CAS number of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine is 1806787-40-5. |
| Q: What is the SMILES notation of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine? |
| A: SMILES notation of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine is Nc1cc(C(F)F)nc(N)c1[N+](=O)[O-]. |
| Q: What is the molecular weight of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine? |
| A: Molecular weight of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine is 204.13. |
| Q: What is the molecular formula of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine? |
| A: Molecular formula of 6-(Difluoromethyl)-3-nitropyridine-2,4-diamine is C6H6F2N4O2. |
| Q: What is the Chinese name of 1806787-40-5? |
| A: Chinese name of 1806787-40-5 is 1806787-40-5. |