2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride
Modify Date: 2026-07-12 19:51:11
2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride structure
|
Common Name | 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1806800-93-0 | Molecular Weight | 251.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8ClF2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8ClF2NO3 |
|---|---|
| Molecular Weight | 251.61 |
| InChIKey | AOPYURZNIUBZCN-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(=O)Cl)c(C(F)F)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride? |
| A: CAS number of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride is 1806800-93-0. |
| Q: What is the molecular formula of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride? |
| A: Molecular formula of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride is C9H8ClF2NO3. |
| Q: What is the SMILES notation of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride? |
| A: SMILES notation of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride is COc1cc(OC)c(C(=O)Cl)c(C(F)F)n1. |
| Q: What is the Chinese name of 1806800-93-0? |
| A: Chinese name of 1806800-93-0 is 1806800-93-0. |
| Q: What is the InChIKey of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride? |
| A: InChIKey of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride is AOPYURZNIUBZCN-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride? |
| A: The English name of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride is 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride. |
| Q: What is the molecular weight of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride? |
| A: Molecular weight of 2-(Difluoromethyl)-4,6-dimethoxypyridine-3-carbonyl chloride is 251.61. |