2-Chloro-6-(difluoromethyl)pyridine-3,4-diol
Modify Date: 2025-09-10 10:54:03
2-Chloro-6-(difluoromethyl)pyridine-3,4-diol structure
|
Common Name | 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 1806826-89-0 | Molecular Weight | 195.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4ClF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H4ClF2NO2 |
|---|---|
| Molecular Weight | 195.55 |
| InChIKey | PEYCPXZNUBZAKQ-UHFFFAOYSA-N |
| SMILES | O=c1cc(C(F)F)[nH]c(Cl)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol? |
| A: InChIKey of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol is PEYCPXZNUBZAKQ-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol? |
| A: The English name of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol is 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol. |
| Q: What is the molecular formula of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol? |
| A: Molecular formula of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol is C6H4ClF2NO2. |
| Q: What is the SMILES notation of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol? |
| A: SMILES notation of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol is O=c1cc(C(F)F)[nH]c(Cl)c1O. |
| Q: What is the Chinese name of 1806826-89-0? |
| A: Chinese name of 1806826-89-0 is 1806826-89-0. |
| Q: What is the CAS number of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol? |
| A: CAS number of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol is 1806826-89-0. |
| Q: What is the molecular weight of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol? |
| A: Molecular weight of 2-Chloro-6-(difluoromethyl)pyridine-3,4-diol is 195.55. |