Polypodine B structure
|
Common Name | Polypodine B | ||
|---|---|---|---|---|
| CAS Number | 18069-14-2 | Molecular Weight | 496.63 | |
| Density | 1.33g/cm3 | Boiling Point | 732.7ºC at 760mmHg | |
| Molecular Formula | C27H44O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 410.8ºC | |
Use of Polypodine BPolypodine B is a natural ecdysone ester isolated from the bark of Dacrydium intermedium[1]. |
| Name | polypodine B |
|---|---|
| Synonym | More Synonyms |
| Description | Polypodine B is a natural ecdysone ester isolated from the bark of Dacrydium intermedium[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. G Russell, et al. Insect Moulting Hormones: The Phytoecdysones of Dacrydium Intermedium. |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 732.7ºC at 760mmHg |
| Molecular Formula | C27H44O8 |
| Molecular Weight | 496.63 |
| Flash Point | 410.8ºC |
| Exact Mass | 496.30400 |
| PSA | 158.68000 |
| LogP | 0.96890 |
| Vapour Pressure | 8.83E-25mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | GMFLGNRCCFYOKL-ACCCYTKYSA-N |
| SMILES | CC(C)(O)CCC(O)C(C)(O)C1CCC2(O)C3=CC(=O)C4(O)CC(O)C(O)CC4(C)C3CCC12C |
| Polypodine |
| polypodin B |
| POLYPODINE B |