imino-(1-methoxycarbonyl-2-oxo-2-phenyl-ethylidene)azanium structure
|
Common Name | imino-(1-methoxycarbonyl-2-oxo-2-phenyl-ethylidene)azanium | ||
|---|---|---|---|---|
| CAS Number | 1807-69-8 | Molecular Weight | 204.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Z)-2-diazonio-3-methoxy-3-oxo-1-phenylprop-1-en-1-olate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8N2O3 |
|---|---|
| Molecular Weight | 204.18200 |
| Exact Mass | 204.05300 |
| PSA | 80.76000 |
| LogP | 0.79416 |
| InChIKey | NBCDTBRUCMPAJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=[N+]=[N-])C(=O)c1ccccc1 |
|
~90%
imino-(1-methox... CAS#:1807-69-8 |
| Literature: Supurgibekov, Murat B.; Prakash, G.K. Surya; Nikolaev, Valerij A. Synthesis (Germany), 2013 , vol. 45, # 9 p. 1215 - 1226 |
|
~%
imino-(1-methox... CAS#:1807-69-8 |
| Literature: Staudinger; Becker; Hirzel Chemische Berichte, 1916 , vol. 49, p. 1984 |
|
~%
imino-(1-methox... CAS#:1807-69-8 |
| Literature: Looker,J.H.; Hayes,C.H. Journal of Organic Chemistry, 1963 , vol. 28, p. 1342 - 1347 |
|
~%
imino-(1-methox... CAS#:1807-69-8 |
| Literature: Staudinger; Becker; Hirzel Chemische Berichte, 1916 , vol. 49, p. 1984 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-Diazo-3-oxo-3-phenyl-propionsaeure-methylester |
| methyl 2-diazobenzoylacetate |
| 2-diazo-3-oxo-3-phenyl-propionic acid methyl ester |
| methyl 2-diazo-3-oxo-3-phenylpropanoate |
| Benzoyl-diazoessigsaeure-methylester |