N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3-diaza-2$l^C26H32N3O4P-phosphacyclohexan-2-amine structure
|
Common Name | N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3-diaza-2$l^C26H32N3O4P-phosphacyclohexan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1807-86-9 | Molecular Weight | 481.52400 | |
| Density | 1.25g/cm3 | Boiling Point | 630ºC at 760 mmHg | |
| Molecular Formula | C26H32N3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 630ºC at 760 mmHg |
| Molecular Formula | C26H32N3O4P |
| Molecular Weight | 481.52400 |
| Flash Point | 334.8ºC |
| Exact Mass | 481.21300 |
| PSA | 73.08000 |
| LogP | 5.58930 |
| Vapour Pressure | 8.77E-16mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | MNQCWBWABWBVAQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN2CCCN(Cc3ccc(OC)cc3)P2(=O)Nc2ccc(OC)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(4-methoxyphe... CAS#:1807-86-9 |
| Literature: Billman,J.H.; Meisenheimer,J.L. J. Med. Chem., 1965 , vol. 8, p. 264 - 265 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine? |
| A: Related upstream materials(CAS) of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine: 51250-37-4;59211-76-6. |
| Q: What is the polar surface area (PSA) of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine? |
| A: Polar surface area (PSA) of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine is 73.08000. |
| Q: What is the InChIKey of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine? |
| A: InChIKey of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine is MNQCWBWABWBVAQ-UHFFFAOYSA-N. |
| Q: What is the boiling point of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine? |
| A: Boiling point of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine is 630ºC at 760 mmHg. |
| Q: What is the molecular weight of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine? |
| A: Molecular weight of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine is 481.52400. |
| Q: What is the LogP of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine? |
| A: LogP of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine is 5.58930. |
| Q: What is the molecular formula of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine? |
| A: Molecular formula of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine is C26H32N3O4P. |
| Q: What is the Chinese name of 1807-86-9? |
| A: Chinese name of 1807-86-9 is 1807-86-9. |
| Q: What is the CAS number of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine? |
| A: CAS number of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine is 1807-86-9. |
| Q: What is the English name of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine? |
| A: The English name of N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine is N-(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]-2-oxo-1,3,2λ5-diazaphosphinan-2-amine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |