Ethyl 2-bromo-6-cyano-4-iodobenzoate structure
|
Common Name | Ethyl 2-bromo-6-cyano-4-iodobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1807015-40-2 | Molecular Weight | 379.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7BrINO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-bromo-6-cyano-4-iodobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7BrINO2 |
|---|---|
| Molecular Weight | 379.98 |
| InChIKey | ODRUHVAGNZDUOM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(Br)cc(I)cc1C#N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1807015-40-2? |
| A: Chinese name of 1807015-40-2 is 1807015-40-2. |
| Q: What is the CAS number of Ethyl 2-bromo-6-cyano-4-iodobenzoate? |
| A: CAS number of Ethyl 2-bromo-6-cyano-4-iodobenzoate is 1807015-40-2. |
| Q: What is the molecular weight of Ethyl 2-bromo-6-cyano-4-iodobenzoate? |
| A: Molecular weight of Ethyl 2-bromo-6-cyano-4-iodobenzoate is 379.98. |
| Q: What is the SMILES notation of Ethyl 2-bromo-6-cyano-4-iodobenzoate? |
| A: SMILES notation of Ethyl 2-bromo-6-cyano-4-iodobenzoate is CCOC(=O)c1c(Br)cc(I)cc1C#N. |
| Q: What is the InChIKey of Ethyl 2-bromo-6-cyano-4-iodobenzoate? |
| A: InChIKey of Ethyl 2-bromo-6-cyano-4-iodobenzoate is ODRUHVAGNZDUOM-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl 2-bromo-6-cyano-4-iodobenzoate? |
| A: The English name of Ethyl 2-bromo-6-cyano-4-iodobenzoate is Ethyl 2-bromo-6-cyano-4-iodobenzoate. |
| Q: What is the molecular formula of Ethyl 2-bromo-6-cyano-4-iodobenzoate? |
| A: Molecular formula of Ethyl 2-bromo-6-cyano-4-iodobenzoate is C10H7BrINO2. |