4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride
Modify Date: 2026-07-19 20:11:21
4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride structure
|
Common Name | 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1807079-54-4 | Molecular Weight | 242.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Cl2F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3Cl2F2NO2 |
|---|---|
| Molecular Weight | 242.00 |
| InChIKey | ZJPSWGKBCDEFPU-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1nc(C(F)F)cc(Cl)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1807079-54-4? |
| A: Chinese name of 1807079-54-4 is 1807079-54-4. |
| Q: What is the InChIKey of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride? |
| A: InChIKey of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride is ZJPSWGKBCDEFPU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride? |
| A: Molecular formula of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride is C7H3Cl2F2NO2. |
| Q: What is the SMILES notation of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride? |
| A: SMILES notation of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride is O=C(Cl)c1nc(C(F)F)cc(Cl)c1O. |
| Q: What is the CAS number of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride? |
| A: CAS number of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride is 1807079-54-4. |
| Q: What is the molecular weight of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride? |
| A: Molecular weight of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride is 242.00. |
| Q: What is the English name of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride? |
| A: The English name of 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride is 4-Chloro-6-(difluoromethyl)-3-hydroxypyridine-2-carbonyl chloride. |