2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride
Modify Date: 2025-09-09 19:36:36
2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride structure
|
Common Name | 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1807115-43-0 | Molecular Weight | 328.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3ClF6O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H3ClF6O3S |
|---|---|
| Molecular Weight | 328.62 |
| InChIKey | ZURZTNVHTFYHAD-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(O)c(C(F)(F)F)c1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride? |
| A: CAS number of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride is 1807115-43-0. |
| Q: What is the English name of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride? |
| A: The English name of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride is 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride. |
| Q: What is the molecular weight of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride? |
| A: Molecular weight of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride is 328.62. |
| Q: What is the molecular formula of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride? |
| A: Molecular formula of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride is C8H3ClF6O3S. |
| Q: What is the SMILES notation of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride? |
| A: SMILES notation of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(O)c(C(F)(F)F)c1C(F)(F)F. |
| Q: What is the InChIKey of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride? |
| A: InChIKey of 2,3-Bis(trifluoromethyl)-4-hydroxybenzenesulfonyl chloride is ZURZTNVHTFYHAD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1807115-43-0? |
| A: Chinese name of 1807115-43-0 is 1807115-43-0. |