2-(2-Cyano-3,5-difluorophenyl)acetic acid
Modify Date: 2026-07-05 07:18:02
2-(2-Cyano-3,5-difluorophenyl)acetic acid structure
|
Common Name | 2-(2-Cyano-3,5-difluorophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1807144-03-1 | Molecular Weight | 197.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-Cyano-3,5-difluorophenyl)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5F2NO2 |
|---|---|
| Molecular Weight | 197.14 |
| InChIKey | CAEHPVBWHLVJIF-UHFFFAOYSA-N |
| SMILES | N#Cc1c(F)cc(F)cc1CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(2-Cyano-3,5-difluorophenyl)acetic acid? |
| A: SMILES notation of 2-(2-Cyano-3,5-difluorophenyl)acetic acid is N#Cc1c(F)cc(F)cc1CC(=O)O. |
| Q: What is the English name of 2-(2-Cyano-3,5-difluorophenyl)acetic acid? |
| A: The English name of 2-(2-Cyano-3,5-difluorophenyl)acetic acid is 2-(2-Cyano-3,5-difluorophenyl)acetic acid. |
| Q: What is the InChIKey of 2-(2-Cyano-3,5-difluorophenyl)acetic acid? |
| A: InChIKey of 2-(2-Cyano-3,5-difluorophenyl)acetic acid is CAEHPVBWHLVJIF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1807144-03-1? |
| A: Chinese name of 1807144-03-1 is 1807144-03-1. |
| Q: What is the CAS number of 2-(2-Cyano-3,5-difluorophenyl)acetic acid? |
| A: CAS number of 2-(2-Cyano-3,5-difluorophenyl)acetic acid is 1807144-03-1. |
| Q: What is the molecular weight of 2-(2-Cyano-3,5-difluorophenyl)acetic acid? |
| A: Molecular weight of 2-(2-Cyano-3,5-difluorophenyl)acetic acid is 197.14. |
| Q: What is the molecular formula of 2-(2-Cyano-3,5-difluorophenyl)acetic acid? |
| A: Molecular formula of 2-(2-Cyano-3,5-difluorophenyl)acetic acid is C9H5F2NO2. |